C19H29FO4 — CID 22910584
2-(4-fluorocyclohex-3-en-1-yl)-5-[2-[5-[(E)-prop-1-enyl]-1,3-dioxan-2-yl]ethyl]-1,3-dioxane (PubChem CID 22910584) has the molecular formula C19H29FO4 and a molecular weight of 340.44 g/mol. Its IUPAC name is 2-(4-fluorocyclohex-3-en-1-yl)-5-[2-[5-[(E)-prop-1-enyl]-1,3-dioxan-2-yl]ethyl]-1,3-dioxane.
| Compound Name | 2-(4-fluorocyclohex-3-en-1-yl)-5-[2-[5-[(E)-prop-1-enyl]-1,3-dioxan-2-yl]ethyl]-1,3-dioxane |
|---|---|
| PubChem CID | 22910584 |
| Molecular Formula | C19H29FO4 |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | 2-(4-fluorocyclohex-3-en-1-yl)-5-[2-[5-[(E)-prop-1-enyl]-1,3-dioxan-2-yl]ethyl]-1,3-dioxane |
| SMILES | C/C=C/C1COC(CCC2COC(C3CC=C(F)CC3)OC2)OC1 |
| InChI | InChI=1S/C19H29FO4/c1-2-3-14-10-21-18(22-11-14)9-4-15-12-23-19(24-13-15)16-5-7-17(20)8-6-16/h2-3,7,14-16,18-19H,4-6,8-13H2,1H3/b3-2+ |
| InChIKey | YMCWFMTVMSFDQA-NSCUHMNNSA-N |
| XLogP | 3.97 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|