C15H23FO2 — CID 22876137
2-(4-fluorocyclohex-3-en-1-yl)-5-[(E)-pent-1-enyl]-1,3-dioxane (PubChem CID 22876137) has the molecular formula C15H23FO2 and a molecular weight of 254.34 g/mol. Its IUPAC name is 2-(4-fluorocyclohex-3-en-1-yl)-5-[(E)-pent-1-enyl]-1,3-dioxane.
| Compound Name | 2-(4-fluorocyclohex-3-en-1-yl)-5-[(E)-pent-1-enyl]-1,3-dioxane |
|---|---|
| PubChem CID | 22876137 |
| Molecular Formula | C15H23FO2 |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | 2-(4-fluorocyclohex-3-en-1-yl)-5-[(E)-pent-1-enyl]-1,3-dioxane |
| SMILES | CCC/C=C/C1COC(C2CC=C(F)CC2)OC1 |
| InChI | InChI=1S/C15H23FO2/c1-2-3-4-5-12-10-17-15(18-11-12)13-6-8-14(16)9-7-13/h4-5,8,12-13,15H,2-3,6-7,9-11H2,1H3/b5-4+ |
| InChIKey | ZDVDSMYXCYBJFJ-SNAWJCMRSA-N |
| XLogP | 3.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|