C16H27FO2 — CID 22876093
5-butyl-2-[2-(4-fluorocyclohex-3-en-1-yl)ethyl]-1,3-dioxane (PubChem CID 22876093) has the molecular formula C16H27FO2 and a molecular weight of 270.39 g/mol. Its IUPAC name is 5-butyl-2-[2-(4-fluorocyclohex-3-en-1-yl)ethyl]-1,3-dioxane.
| Compound Name | 5-butyl-2-[2-(4-fluorocyclohex-3-en-1-yl)ethyl]-1,3-dioxane |
|---|---|
| PubChem CID | 22876093 |
| Molecular Formula | C16H27FO2 |
| Molecular Weight | 270.39 g/mol |
| Exact Mass | 270.20 |
| IUPAC Name | 5-butyl-2-[2-(4-fluorocyclohex-3-en-1-yl)ethyl]-1,3-dioxane |
| SMILES | CCCCC1COC(CCC2CC=C(F)CC2)OC1 |
| InChI | InChI=1S/C16H27FO2/c1-2-3-4-14-11-18-16(19-12-14)10-7-13-5-8-15(17)9-6-13/h8,13-14,16H,2-7,9-12H2,1H3 |
| InChIKey | AVYYVGIFRQFVGX-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.39 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |