C12H19FO2 — CID 22876136
5-ethyl-2-(4-fluorocyclohex-3-en-1-yl)-1,3-dioxane (PubChem CID 22876136) has the molecular formula C12H19FO2 and a molecular weight of 214.28 g/mol. Its IUPAC name is 5-ethyl-2-(4-fluorocyclohex-3-en-1-yl)-1,3-dioxane.
| Compound Name | 5-ethyl-2-(4-fluorocyclohex-3-en-1-yl)-1,3-dioxane |
|---|---|
| PubChem CID | 22876136 |
| Molecular Formula | C12H19FO2 |
| Molecular Weight | 214.28 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | 5-ethyl-2-(4-fluorocyclohex-3-en-1-yl)-1,3-dioxane |
| SMILES | CCC1COC(C2CC=C(F)CC2)OC1 |
| InChI | InChI=1S/C12H19FO2/c1-2-9-7-14-12(15-8-9)10-3-5-11(13)6-4-10/h5,9-10,12H,2-4,6-8H2,1H3 |
| InChIKey | BIIAHGGMAPDMON-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.28 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |