C11H14N2O2 — CID 54262288
(1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)carbamic acid (PubChem CID 54262288) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is (1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)carbamic acid.
| Compound Name | (1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)carbamic acid |
|---|---|
| PubChem CID | 54262288 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | (1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)carbamic acid |
| SMILES | CC1c2ccccc2CCN1NC(=O)O |
| InChI | InChI=1S/C11H14N2O2/c1-8-10-5-3-2-4-9(10)6-7-13(8)12-11(14)15/h2-5,8,12H,6-7H2,1H3,(H,14,15) |
| InChIKey | REIRBOUBQARBHA-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |