C11H12NNaS2 — CID 71677706
sodium 1-methyl-3,4-dihydro-1H-isoquinoline-2-carbodithioate (PubChem CID 71677706) has the molecular formula C11H12NNaS2 and a molecular weight of 245.35 g/mol. Its IUPAC name is sodium 1-methyl-3,4-dihydro-1H-isoquinoline-2-carbodithioate.
| Compound Name | sodium 1-methyl-3,4-dihydro-1H-isoquinoline-2-carbodithioate |
|---|---|
| PubChem CID | 71677706 |
| Molecular Formula | C11H12NNaS2 |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.03 |
| IUPAC Name | sodium 1-methyl-3,4-dihydro-1H-isoquinoline-2-carbodithioate |
| SMILES | CC1c2ccccc2CCN1C(=S)[S-].[Na+] |
| InChI | InChI=1S/C11H13NS2.Na/c1-8-10-5-3-2-4-9(10)6-7-12(8)11(13)14;/h2-5,8H,6-7H2,1H3,(H,13,14);/q;+1/p-1 |
| InChIKey | JSCINIVPEBDUSG-UHFFFAOYSA-M |
| XLogP | -0.56 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|