C14H13FN2O4 — CID 54264648
2-(2-fluoro-5-nitrophenyl)-4,5,6,7-tetrahydroisoindole-1,3-diol (PubChem CID 54264648) has the molecular formula C14H13FN2O4 and a molecular weight of 292.27 g/mol. Its IUPAC name is 2-(2-fluoro-5-nitrophenyl)-4,5,6,7-tetrahydroisoindole-1,3-diol.
| Compound Name | 2-(2-fluoro-5-nitrophenyl)-4,5,6,7-tetrahydroisoindole-1,3-diol |
|---|---|
| PubChem CID | 54264648 |
| Molecular Formula | C14H13FN2O4 |
| Molecular Weight | 292.27 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 2-(2-fluoro-5-nitrophenyl)-4,5,6,7-tetrahydroisoindole-1,3-diol |
| SMILES | O=[N+]([O-])c1ccc(F)c(-n2c(O)c3c(c2O)CCCC3)c1 |
| InChI | InChI=1S/C14H13FN2O4/c15-11-6-5-8(17(20)21)7-12(11)16-13(18)9-3-1-2-4-10(9)14(16)19/h5-7,18-19H,1-4H2 |
| InChIKey | RFXKAVWRLUUQHA-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 88.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.27 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|