C32H20Cl4N6 — CID 54264747
2,3,5,6-tetrakis[2-(5-chloro-2-pyridinyl)ethenyl]pyrazine (PubChem CID 54264747) has the molecular formula C32H20Cl4N6 and a molecular weight of 630.37 g/mol. Its IUPAC name is 2,3,5,6-tetrakis[2-(5-chloro-2-pyridinyl)ethenyl]pyrazine.
| Compound Name | 2,3,5,6-tetrakis[2-(5-chloro-2-pyridinyl)ethenyl]pyrazine |
|---|---|
| PubChem CID | 54264747 |
| Molecular Formula | C32H20Cl4N6 |
| Molecular Weight | 630.37 g/mol |
| Exact Mass | 628.05 |
| IUPAC Name | 2,3,5,6-tetrakis[2-(5-chloro-2-pyridinyl)ethenyl]pyrazine |
| SMILES | Clc1ccc(C=Cc2nc(C=Cc3ccc(Cl)cn3)c(C=Cc3ccc(Cl)cn3)nc2C=Cc2ccc(Cl)cn2)nc1 |
| InChI | InChI=1S/C32H20Cl4N6/c33-21-1-5-25(37-17-21)9-13-29-30(14-10-26-6-2-22(34)18-38-26)42-32(16-12-28-8-4-24(36)20-40-28)31(41-29)15-11-27-7-3-23(35)19-39-27/h1-20H |
| InChIKey | RFYVFDDEDOODOR-UHFFFAOYSA-N |
| XLogP | 9.35 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.37 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |