C22H42N4O2 — CID 54264997
N-butyl-3-[6-[[4-(butylamino)-4-oxobutan-2-ylidene]amino]hexylimino]butanamide (PubChem CID 54264997) has the molecular formula C22H42N4O2 and a molecular weight of 394.60 g/mol. Its IUPAC name is N-butyl-3-[6-[[4-(butylamino)-4-oxobutan-2-ylidene]amino]hexylimino]butanamide.
| Compound Name | N-butyl-3-[6-[[4-(butylamino)-4-oxobutan-2-ylidene]amino]hexylimino]butanamide |
|---|---|
| PubChem CID | 54264997 |
| Molecular Formula | C22H42N4O2 |
| Molecular Weight | 394.60 g/mol |
| Exact Mass | 394.33 |
| IUPAC Name | N-butyl-3-[6-[[4-(butylamino)-4-oxobutan-2-ylidene]amino]hexylimino]butanamide |
| SMILES | CCCCNC(=O)C/C(C)=N/CCCCCC/N=C(\C)CC(=O)NCCCC |
| InChI | InChI=1S/C22H42N4O2/c1-5-7-13-25-21(27)17-19(3)23-15-11-9-10-12-16-24-20(4)18-22(28)26-14-8-6-2/h5-18H2,1-4H3,(H,25,27)(H,26,28)/b23-19+,24-20+ |
| InChIKey | RGDKOEWITDLTQM-BLVCXSLXSA-N |
| XLogP | 4.08 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.60 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|