C33H37N3O5 — CID 54270593
N-[2-(4-hydroxyphenyl)ethyl]-2-[3-[(4-hydroxyphenyl)methyl]-1,4-dioxo-3,6,11,11a-tetrahydropyrazino[1,2-b]isoquinolin-2-yl]-4-methylpentanamide (PubChem CID 54270593) has the molecular formula C33H37N3O5 and a molecular weight of 555.68 g/mol. Its IUPAC name is N-[2-(4-hydroxyphenyl)ethyl]-2-[3-[(4-hydroxyphenyl)methyl]-1,4-dioxo-3,6,11,11a-tetrahydropyrazino[1,2-b]isoquinolin-2-yl]-4-methylpentanamide.
| Compound Name | N-[2-(4-hydroxyphenyl)ethyl]-2-[3-[(4-hydroxyphenyl)methyl]-1,4-dioxo-3,6,11,11a-tetrahydropyrazino[1,2-b]isoquinolin-2-yl]-4-methylpentanamide |
|---|---|
| PubChem CID | 54270593 |
| Molecular Formula | C33H37N3O5 |
| Molecular Weight | 555.68 g/mol |
| Exact Mass | 555.27 |
| IUPAC Name | N-[2-(4-hydroxyphenyl)ethyl]-2-[3-[(4-hydroxyphenyl)methyl]-1,4-dioxo-3,6,11,11a-tetrahydropyrazino[1,2-b]isoquinolin-2-yl]-4-methylpentanamide |
| SMILES | CC(C)CC(C(=O)NCCc1ccc(O)cc1)N1C(=O)C2Cc3ccccc3CN2C(=O)C1Cc1ccc(O)cc1 |
| InChI | InChI=1S/C33H37N3O5/c1-21(2)17-28(31(39)34-16-15-22-7-11-26(37)12-8-22)36-30(18-23-9-13-27(38)14-10-23)32(40)35-20-25-6-4-3-5-24(25)19-29(35)33(36)41/h3-14,21,28-30,37-38H,15-20H2,1-2H3,(H,34,39) |
| InChIKey | RJVBZNHFIVMMGW-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 110.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.68 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |