C37H40N4O4 — CID 18689595
2-(4-cyanophenyl)-2-[3-(cyclohexylmethyl)-1,4-dioxo-3,6,11,11a-tetrahydropyrazino[1,2-b]isoquinolin-2-yl]-N-[2-(4-methoxyphenyl)ethyl]acetamide (PubChem CID 18689595) has the molecular formula C37H40N4O4 and a molecular weight of 604.75 g/mol. Its IUPAC name is 2-(4-cyanophenyl)-2-[3-(cyclohexylmethyl)-1,4-dioxo-3,6,11,11a-tetrahydropyrazino[1,2-b]isoquinolin-2-yl]-N-[2-(4-methoxyphenyl)ethyl]acetamide.
| Compound Name | 2-(4-cyanophenyl)-2-[3-(cyclohexylmethyl)-1,4-dioxo-3,6,11,11a-tetrahydropyrazino[1,2-b]isoquinolin-2-yl]-N-[2-(4-methoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 18689595 |
| Molecular Formula | C37H40N4O4 |
| Molecular Weight | 604.75 g/mol |
| Exact Mass | 604.30 |
| IUPAC Name | 2-(4-cyanophenyl)-2-[3-(cyclohexylmethyl)-1,4-dioxo-3,6,11,11a-tetrahydropyrazino[1,2-b]isoquinolin-2-yl]-N-[2-(4-methoxyphenyl)ethyl]acetamide |
| SMILES | COc1ccc(CCNC(=O)C(c2ccc(C#N)cc2)N2C(=O)C3Cc4ccccc4CN3C(=O)C2CC2CCCCC2)cc1 |
| InChI | InChI=1S/C37H40N4O4/c1-45-31-17-13-25(14-18-31)19-20-39-35(42)34(28-15-11-27(23-38)12-16-28)41-33(21-26-7-3-2-4-8-26)36(43)40-24-30-10-6-5-9-29(30)22-32(40)37(41)44/h5-6,9-18,26,32-34H,2-4,7-8,19-22,24H2,1H3,(H,39,42) |
| InChIKey | WEHGIIXPDQZTBY-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.75 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |