C24H26F3N3O3S — CID 54273659
N-[5-[(3-butyl-1-ethyl-5-formylpyrazol-4-yl)methyl]-2-phenylphenyl]-1,1,1-trifluoromethanesulfonamide (PubChem CID 54273659) has the molecular formula C24H26F3N3O3S and a molecular weight of 493.55 g/mol. Its IUPAC name is N-[5-[(3-butyl-1-ethyl-5-formylpyrazol-4-yl)methyl]-2-phenylphenyl]-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-[5-[(3-butyl-1-ethyl-5-formylpyrazol-4-yl)methyl]-2-phenylphenyl]-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 54273659 |
| Molecular Formula | C24H26F3N3O3S |
| Molecular Weight | 493.55 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | N-[5-[(3-butyl-1-ethyl-5-formylpyrazol-4-yl)methyl]-2-phenylphenyl]-1,1,1-trifluoromethanesulfonamide |
| SMILES | CCCCc1nn(CC)c(C=O)c1Cc1ccc(-c2ccccc2)c(NS(=O)(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C24H26F3N3O3S/c1-3-5-11-21-20(23(16-31)30(4-2)28-21)14-17-12-13-19(18-9-7-6-8-10-18)22(15-17)29-34(32,33)24(25,26)27/h6-10,12-13,15-16,29H,3-5,11,14H2,1-2H3 |
| InChIKey | RLWVZXZSIUFBOL-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.55 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|