C28H31ClN2O7S — CID 54273755
(4-methoxyphenyl)methyl 2-chloro-2-[(2R,3R)-2-[2-(5-methyloxolan-2-yl)-2-oxoethyl]sulfanyl-4-oxo-3-[(2-phenylacetyl)amino]azetidin-1-yl]acetate (PubChem CID 54273755) has the molecular formula C28H31ClN2O7S and a molecular weight of 575.08 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl 2-chloro-2-[(2R,3R)-2-[2-(5-methyloxolan-2-yl)-2-oxoethyl]sulfanyl-4-oxo-3-[(2-phenylacetyl)amino]azetidin-1-yl]acetate.
| Compound Name | (4-methoxyphenyl)methyl 2-chloro-2-[(2R,3R)-2-[2-(5-methyloxolan-2-yl)-2-oxoethyl]sulfanyl-4-oxo-3-[(2-phenylacetyl)amino]azetidin-1-yl]acetate |
|---|---|
| PubChem CID | 54273755 |
| Molecular Formula | C28H31ClN2O7S |
| Molecular Weight | 575.08 g/mol |
| Exact Mass | 574.15 |
| IUPAC Name | (4-methoxyphenyl)methyl 2-chloro-2-[(2R,3R)-2-[2-(5-methyloxolan-2-yl)-2-oxoethyl]sulfanyl-4-oxo-3-[(2-phenylacetyl)amino]azetidin-1-yl]acetate |
| SMILES | COc1ccc(COC(=O)C(Cl)N2C(=O)[C@@H](NC(=O)Cc3ccccc3)[C@H]2SCC(=O)C2CCC(C)O2)cc1 |
| InChI | InChI=1S/C28H31ClN2O7S/c1-17-8-13-22(38-17)21(32)16-39-27-24(30-23(33)14-18-6-4-3-5-7-18)26(34)31(27)25(29)28(35)37-15-19-9-11-20(36-2)12-10-19/h3-7,9-12,17,22,24-25,27H,8,13-16H2,1-2H3,(H,30,33)/t17?,22?,24-,25?,27-/m1/s1 |
| InChIKey | RLYRXJPGYVETFP-RRLOHOOOSA-N |
| XLogP | 3.07 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.08 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|