C13H18 — CID 54274738
2-hexa-1,3,4-trienylbicyclo[2.2.1]heptane (PubChem CID 54274738) has the molecular formula C13H18 and a molecular weight of 174.29 g/mol. Its IUPAC name is 2-hexa-1,3,4-trienylbicyclo[2.2.1]heptane.
| Compound Name | 2-hexa-1,3,4-trienylbicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 54274738 |
| Molecular Formula | C13H18 |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | 2-hexa-1,3,4-trienylbicyclo[2.2.1]heptane |
| SMILES | CC=C=CC=CC1CC2CCC1C2 |
| InChI | InChI=1S/C13H18/c1-2-3-4-5-6-12-9-11-7-8-13(12)10-11/h2,4-6,11-13H,7-10H2,1H3 |
| InChIKey | RMQBBVMWJDSBGS-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|