About 3-diazenylbenzonitrile
3-diazenylbenzonitrile (PubChem CID 54274843) has the molecular formula C7H5N3
and a molecular weight of 131.14 g/mol. Its IUPAC name is 3-diazenylbenzonitrile.
Molecular Properties
| Compound Name | 3-diazenylbenzonitrile |
| PubChem CID | 54274843 |
| Molecular Formula | C7H5N3 |
| Molecular Weight | 131.14 g/mol |
| Exact Mass | 131.05 |
| IUPAC Name | 3-diazenylbenzonitrile |
| SMILES | [H]/N=N/c1cccc(C#N)c1 |
| InChI | InChI=1S/C7H5N3/c8-5-6-2-1-3-7(4-6)10-9/h1-4,9H/b10-9+ |
| InChIKey | SUZBYOASFGBMTG-MDZDMXLPSA-N |
| XLogP | 2.22 |
| TPSA | 60.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.14 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-diazenylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-diazenylbenzonitrile?
The IUPAC name of 3-diazenylbenzonitrile (CID 54274843) is 3-diazenylbenzonitrile.
What is the SMILES notation for 3-diazenylbenzonitrile?
The canonical SMILES for 3-diazenylbenzonitrile is [H]/N=N/c1cccc(C#N)c1.
What is the InChIKey of 3-diazenylbenzonitrile?
The InChIKey is SUZBYOASFGBMTG-MDZDMXLPSA-N. The full InChI is InChI=1S/C7H5N3/c8-5-6-2-1-3-7(4-6)10-9/h1-4,9H/b10-9+.
What are the key properties of 3-diazenylbenzonitrile?
3-diazenylbenzonitrile has a molecular weight of 131.14 g/mol, XLogP of 2.22, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-diazenylbenzonitrile is sourced from PubChem (CID 54274843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).