C41H56N2O — CID 54275142
N,N-dicyclohexyl-4-[1-[4-[2-(dimethylamino)ethoxy]phenyl]-2-(4-propan-2-ylphenyl)but-1-enyl]aniline (PubChem CID 54275142) has the molecular formula C41H56N2O and a molecular weight of 592.91 g/mol. Its IUPAC name is N,N-dicyclohexyl-4-[1-[4-[2-(dimethylamino)ethoxy]phenyl]-2-(4-propan-2-ylphenyl)but-1-enyl]aniline.
| Compound Name | N,N-dicyclohexyl-4-[1-[4-[2-(dimethylamino)ethoxy]phenyl]-2-(4-propan-2-ylphenyl)but-1-enyl]aniline |
|---|---|
| PubChem CID | 54275142 |
| Molecular Formula | C41H56N2O |
| Molecular Weight | 592.91 g/mol |
| Exact Mass | 592.44 |
| IUPAC Name | N,N-dicyclohexyl-4-[1-[4-[2-(dimethylamino)ethoxy]phenyl]-2-(4-propan-2-ylphenyl)but-1-enyl]aniline |
| SMILES | CCC(=C(c1ccc(OCCN(C)C)cc1)c1ccc(N(C2CCCCC2)C2CCCCC2)cc1)c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C41H56N2O/c1-6-40(33-19-17-32(18-20-33)31(2)3)41(35-23-27-39(28-24-35)44-30-29-42(4)5)34-21-25-38(26-22-34)43(36-13-9-7-10-14-36)37-15-11-8-12-16-37/h17-28,31,36-37H,6-16,29-30H2,1-5H3 |
| InChIKey | RMWWBLPFXYUMDV-UHFFFAOYSA-N |
| XLogP | 10.59 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.91 |
| LogP ≤ 5 | 10.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|