About 1-(2,5-dihydroxypyrrol-1-yl)-2,2,2-trifluoroethanone
1-(2,5-dihydroxypyrrol-1-yl)-2,2,2-trifluoroethanone (PubChem CID 54277587) has the molecular formula C6H4F3NO3
and a molecular weight of 195.10 g/mol. Its IUPAC name is 1-(2,5-dihydroxypyrrol-1-yl)-2,2,2-trifluoroethanone.
Analyze 1-(2,5-dihydroxypyrrol-1-yl)-2,2,2-trifluoroethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,5-dihydroxypyrrol-1-yl)-2,2,2-trifluoroethanone?
The IUPAC name of 1-(2,5-dihydroxypyrrol-1-yl)-2,2,2-trifluoroethanone (CID 54277587) is 1-(2,5-dihydroxypyrrol-1-yl)-2,2,2-trifluoroethanone.
What is the SMILES notation for 1-(2,5-dihydroxypyrrol-1-yl)-2,2,2-trifluoroethanone?
The canonical SMILES for 1-(2,5-dihydroxypyrrol-1-yl)-2,2,2-trifluoroethanone is O=C(n1c(O)ccc1O)C(F)(F)F.
What is the InChIKey of 1-(2,5-dihydroxypyrrol-1-yl)-2,2,2-trifluoroethanone?
The InChIKey is ROMNMZALNLZCBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4F3NO3/c7-6(8,9)5(13)10-3(11)1-2-4(10)12/h1-2,11-12H.
What are the key properties of 1-(2,5-dihydroxypyrrol-1-yl)-2,2,2-trifluoroethanone?
1-(2,5-dihydroxypyrrol-1-yl)-2,2,2-trifluoroethanone has a molecular weight of 195.10 g/mol, XLogP of 1.10, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,5-dihydroxypyrrol-1-yl)-2,2,2-trifluoroethanone is sourced from PubChem (CID 54277587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).