C11H22O6P2 — CID 54278040
[3-bis(prop-1-enoxy)phosphoryl-2,2-dimethylpropyl]phosphonic acid (PubChem CID 54278040) has the molecular formula C11H22O6P2 and a molecular weight of 312.24 g/mol. Its IUPAC name is [3-bis(prop-1-enoxy)phosphoryl-2,2-dimethylpropyl]phosphonic acid.
| Compound Name | [3-bis(prop-1-enoxy)phosphoryl-2,2-dimethylpropyl]phosphonic acid |
|---|---|
| PubChem CID | 54278040 |
| Molecular Formula | C11H22O6P2 |
| Molecular Weight | 312.24 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | [3-bis(prop-1-enoxy)phosphoryl-2,2-dimethylpropyl]phosphonic acid |
| SMILES | CC=COP(=O)(CC(C)(C)CP(=O)(O)O)OC=CC |
| InChI | InChI=1S/C11H22O6P2/c1-5-7-16-19(15,17-8-6-2)10-11(3,4)9-18(12,13)14/h5-8H,9-10H2,1-4H3,(H2,12,13,14) |
| InChIKey | MPOLZHNNYBTMSM-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.24 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|