C14H15N3O2S — CID 5427947
2-(4-methoxyanilino)-N-[(Z)-thiophen-2-ylmethylideneamino]acetamide (PubChem CID 5427947) has the molecular formula C14H15N3O2S and a molecular weight of 289.36 g/mol. Its IUPAC name is 2-(4-methoxyanilino)-N-[(Z)-thiophen-2-ylmethylideneamino]acetamide.
| Compound Name | 2-(4-methoxyanilino)-N-[(Z)-thiophen-2-ylmethylideneamino]acetamide |
|---|---|
| PubChem CID | 5427947 |
| Molecular Formula | C14H15N3O2S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 2-(4-methoxyanilino)-N-[(Z)-thiophen-2-ylmethylideneamino]acetamide |
| SMILES | COc1ccc(NCC(=O)N/N=C\c2cccs2)cc1 |
| InChI | InChI=1S/C14H15N3O2S/c1-19-12-6-4-11(5-7-12)15-10-14(18)17-16-9-13-3-2-8-20-13/h2-9,15H,10H2,1H3,(H,17,18)/b16-9- |
| InChIKey | ALWOAPDTDZZVRX-SXGWCWSVSA-N |
| XLogP | 2.32 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|