C16H12ClNS2 — CID 54283901
2-chloro-5-(4-methylsulfanylphenyl)-4-phenyl-1,3-thiazole (PubChem CID 54283901) has the molecular formula C16H12ClNS2 and a molecular weight of 317.87 g/mol. Its IUPAC name is 2-chloro-5-(4-methylsulfanylphenyl)-4-phenyl-1,3-thiazole.
| Compound Name | 2-chloro-5-(4-methylsulfanylphenyl)-4-phenyl-1,3-thiazole |
|---|---|
| PubChem CID | 54283901 |
| Molecular Formula | C16H12ClNS2 |
| Molecular Weight | 317.87 g/mol |
| Exact Mass | 317.01 |
| IUPAC Name | 2-chloro-5-(4-methylsulfanylphenyl)-4-phenyl-1,3-thiazole |
| SMILES | CSc1ccc(-c2sc(Cl)nc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C16H12ClNS2/c1-19-13-9-7-12(8-10-13)15-14(18-16(17)20-15)11-5-3-2-4-6-11/h2-10H,1H3 |
| InChIKey | RSSXSZDUQRGCFE-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.87 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |