C21H44O9 — CID 54284266
2-[4-[3,3-bis(2-hydroxyethoxymethyl)pentoxy]-2-(2-hydroxyethoxymethyl)-2-methylbutoxy]ethanol (PubChem CID 54284266) has the molecular formula C21H44O9 and a molecular weight of 440.57 g/mol. Its IUPAC name is 2-[4-[3,3-bis(2-hydroxyethoxymethyl)pentoxy]-2-(2-hydroxyethoxymethyl)-2-methylbutoxy]ethanol.
| Compound Name | 2-[4-[3,3-bis(2-hydroxyethoxymethyl)pentoxy]-2-(2-hydroxyethoxymethyl)-2-methylbutoxy]ethanol |
|---|---|
| PubChem CID | 54284266 |
| Molecular Formula | C21H44O9 |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.30 |
| IUPAC Name | 2-[4-[3,3-bis(2-hydroxyethoxymethyl)pentoxy]-2-(2-hydroxyethoxymethyl)-2-methylbutoxy]ethanol |
| SMILES | CCC(CCOCCC(C)(COCCO)COCCO)(COCCO)COCCO |
| InChI | InChI=1S/C21H44O9/c1-3-21(18-29-14-8-24,19-30-15-9-25)5-11-26-10-4-20(2,16-27-12-6-22)17-28-13-7-23/h22-25H,3-19H2,1-2H3 |
| InChIKey | RSZLFLXKXYGRDD-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 127.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|