C30H56O6S3 — CID 54287553
O-[2-[2,3-bis(2-heptanethioyloxyethoxy)propoxy]ethyl] heptanethioate (PubChem CID 54287553) has the molecular formula C30H56O6S3 and a molecular weight of 608.97 g/mol. Its IUPAC name is O-[2-[2,3-bis(2-heptanethioyloxyethoxy)propoxy]ethyl] heptanethioate.
| Compound Name | O-[2-[2,3-bis(2-heptanethioyloxyethoxy)propoxy]ethyl] heptanethioate |
|---|---|
| PubChem CID | 54287553 |
| Molecular Formula | C30H56O6S3 |
| Molecular Weight | 608.97 g/mol |
| Exact Mass | 608.32 |
| IUPAC Name | O-[2-[2,3-bis(2-heptanethioyloxyethoxy)propoxy]ethyl] heptanethioate |
| SMILES | CCCCCCC(=S)OCCOCC(COCCOC(=S)CCCCCC)OCCOC(=S)CCCCCC |
| InChI | InChI=1S/C30H56O6S3/c1-4-7-10-13-16-28(37)34-21-19-31-25-27(33-23-24-36-30(39)18-15-12-9-6-3)26-32-20-22-35-29(38)17-14-11-8-5-2/h27H,4-26H2,1-3H3 |
| InChIKey | RVFCQCKOFKWQNU-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.97 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|