C12H9Br3N2O — CID 54289722
2-[2-(4-methylphenyl)ethenyl]-5-(tribromomethyl)-1,3,4-oxadiazole (PubChem CID 54289722) has the molecular formula C12H9Br3N2O and a molecular weight of 436.93 g/mol. Its IUPAC name is 2-[2-(4-methylphenyl)ethenyl]-5-(tribromomethyl)-1,3,4-oxadiazole.
| Compound Name | 2-[2-(4-methylphenyl)ethenyl]-5-(tribromomethyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 54289722 |
| Molecular Formula | C12H9Br3N2O |
| Molecular Weight | 436.93 g/mol |
| Exact Mass | 433.83 |
| IUPAC Name | 2-[2-(4-methylphenyl)ethenyl]-5-(tribromomethyl)-1,3,4-oxadiazole |
| SMILES | Cc1ccc(C=Cc2nnc(C(Br)(Br)Br)o2)cc1 |
| InChI | InChI=1S/C12H9Br3N2O/c1-8-2-4-9(5-3-8)6-7-10-16-17-11(18-10)12(13,14)15/h2-7H,1H3 |
| InChIKey | RWQIMMCSWVNHGP-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.93 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|