C19H13Cl3N2O — CID 154525170
2-[(Z)-2-[4-[(Z)-2-phenylethenyl]phenyl]ethenyl]-5-(trichloromethyl)-1,3,4-oxadiazole (PubChem CID 154525170) has the molecular formula C19H13Cl3N2O and a molecular weight of 391.69 g/mol. Its IUPAC name is 2-[(Z)-2-[4-[(Z)-2-phenylethenyl]phenyl]ethenyl]-5-(trichloromethyl)-1,3,4-oxadiazole.
| Compound Name | 2-[(Z)-2-[4-[(Z)-2-phenylethenyl]phenyl]ethenyl]-5-(trichloromethyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 154525170 |
| Molecular Formula | C19H13Cl3N2O |
| Molecular Weight | 391.69 g/mol |
| Exact Mass | 390.01 |
| IUPAC Name | 2-[(Z)-2-[4-[(Z)-2-phenylethenyl]phenyl]ethenyl]-5-(trichloromethyl)-1,3,4-oxadiazole |
| SMILES | ClC(Cl)(Cl)c1nnc(/C=C\c2ccc(/C=C\c3ccccc3)cc2)o1 |
| InChI | InChI=1S/C19H13Cl3N2O/c20-19(21,22)18-24-23-17(25-18)13-12-16-10-8-15(9-11-16)7-6-14-4-2-1-3-5-14/h1-13H/b7-6-,13-12- |
| InChIKey | WNIBOEDSTLUPQG-ASZCUJMBSA-N |
| XLogP | 6.24 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.69 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|