C29H36N6O4S — CID 54289829
(2S)-1-[(2S)-2-[4-(hydrazinylmethylideneamino)butyl-naphthalen-2-ylsulfonylamino]-3-phenylpropanoyl]pyrrolidine-2-carboxamide (PubChem CID 54289829) has the molecular formula C29H36N6O4S and a molecular weight of 564.71 g/mol. Its IUPAC name is (2S)-1-[(2S)-2-[4-(hydrazinylmethylideneamino)butyl-naphthalen-2-ylsulfonylamino]-3-phenylpropanoyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[(2S)-2-[4-(hydrazinylmethylideneamino)butyl-naphthalen-2-ylsulfonylamino]-3-phenylpropanoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 54289829 |
| Molecular Formula | C29H36N6O4S |
| Molecular Weight | 564.71 g/mol |
| Exact Mass | 564.25 |
| IUPAC Name | (2S)-1-[(2S)-2-[4-(hydrazinylmethylideneamino)butyl-naphthalen-2-ylsulfonylamino]-3-phenylpropanoyl]pyrrolidine-2-carboxamide |
| SMILES | NN/C=N/CCCCN([C@@H](Cc1ccccc1)C(=O)N1CCC[C@H]1C(N)=O)S(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C29H36N6O4S/c30-28(36)26-13-8-17-34(26)29(37)27(19-22-9-2-1-3-10-22)35(18-7-6-16-32-21-33-31)40(38,39)25-15-14-23-11-4-5-12-24(23)20-25/h1-5,9-12,14-15,20-21,26-27H,6-8,13,16-19,31H2,(H2,30,36)(H,32,33)/t26-,27-/m0/s1 |
| InChIKey | RWSCHMUTWFXERS-SVBPBHIXSA-N |
| XLogP | 2.19 |
| TPSA | 151.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.71 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|