C21H20ClNO2 — CID 54290314
(2R)-1-(2-chloro-4-phenylphenoxy)-4-pyridin-3-ylbutan-2-ol (PubChem CID 54290314) has the molecular formula C21H20ClNO2 and a molecular weight of 353.85 g/mol. Its IUPAC name is (2R)-1-(2-chloro-4-phenylphenoxy)-4-pyridin-3-ylbutan-2-ol.
| Compound Name | (2R)-1-(2-chloro-4-phenylphenoxy)-4-pyridin-3-ylbutan-2-ol |
|---|---|
| PubChem CID | 54290314 |
| Molecular Formula | C21H20ClNO2 |
| Molecular Weight | 353.85 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | (2R)-1-(2-chloro-4-phenylphenoxy)-4-pyridin-3-ylbutan-2-ol |
| SMILES | O[C@H](CCc1cccnc1)COc1ccc(-c2ccccc2)cc1Cl |
| InChI | InChI=1S/C21H20ClNO2/c22-20-13-18(17-6-2-1-3-7-17)9-11-21(20)25-15-19(24)10-8-16-5-4-12-23-14-16/h1-7,9,11-14,19,24H,8,10,15H2/t19-/m1/s1 |
| InChIKey | RXAVAOJYCADCPV-LJQANCHMSA-N |
| XLogP | 4.77 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.85 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |