C22H23NO2 — CID 59970467
(4R)-4-(4-phenylphenoxy)-1-pyridin-3-ylpentan-3-ol (PubChem CID 59970467) has the molecular formula C22H23NO2 and a molecular weight of 333.43 g/mol. Its IUPAC name is (4R)-4-(4-phenylphenoxy)-1-pyridin-3-ylpentan-3-ol.
| Compound Name | (4R)-4-(4-phenylphenoxy)-1-pyridin-3-ylpentan-3-ol |
|---|---|
| PubChem CID | 59970467 |
| Molecular Formula | C22H23NO2 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | (4R)-4-(4-phenylphenoxy)-1-pyridin-3-ylpentan-3-ol |
| SMILES | C[C@@H](Oc1ccc(-c2ccccc2)cc1)C(O)CCc1cccnc1 |
| InChI | InChI=1S/C22H23NO2/c1-17(22(24)14-9-18-6-5-15-23-16-18)25-21-12-10-20(11-13-21)19-7-3-2-4-8-19/h2-8,10-13,15-17,22,24H,9,14H2,1H3/t17-,22?/m1/s1 |
| InChIKey | XZUSIPDBUGNOCM-PLEWWHCXSA-N |
| XLogP | 4.51 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |