C21H25N3O3 — CID 141004420
(3R,4S)-4-[4-(2-methoxy-2H-pyrimidin-1-yl)phenoxy]-1-pyridin-3-ylpentan-3-ol (PubChem CID 141004420) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is (3R,4S)-4-[4-(2-methoxy-2H-pyrimidin-1-yl)phenoxy]-1-pyridin-3-ylpentan-3-ol.
| Compound Name | (3R,4S)-4-[4-(2-methoxy-2H-pyrimidin-1-yl)phenoxy]-1-pyridin-3-ylpentan-3-ol |
|---|---|
| PubChem CID | 141004420 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | (3R,4S)-4-[4-(2-methoxy-2H-pyrimidin-1-yl)phenoxy]-1-pyridin-3-ylpentan-3-ol |
| SMILES | COC1N=CC=CN1c1ccc(O[C@@H](C)[C@H](O)CCc2cccnc2)cc1 |
| InChI | InChI=1S/C21H25N3O3/c1-16(20(25)11-6-17-5-3-12-22-15-17)27-19-9-7-18(8-10-19)24-14-4-13-23-21(24)26-2/h3-5,7-10,12-16,20-21,25H,6,11H2,1-2H3/t16-,20+,21?/m0/s1 |
| InChIKey | UJMXPSGQOZXTGL-ICTUGDKOSA-N |
| XLogP | 3.18 |
| TPSA | 67.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |