C23H22F3NO3 — CID 162542819
(3R,4S)-1-pyridin-3-yl-4-[4-[2-(trifluoromethoxy)phenyl]phenoxy]pentan-3-ol (PubChem CID 162542819) has the molecular formula C23H22F3NO3 and a molecular weight of 417.43 g/mol. Its IUPAC name is (3R,4S)-1-pyridin-3-yl-4-[4-[2-(trifluoromethoxy)phenyl]phenoxy]pentan-3-ol.
| Compound Name | (3R,4S)-1-pyridin-3-yl-4-[4-[2-(trifluoromethoxy)phenyl]phenoxy]pentan-3-ol |
|---|---|
| PubChem CID | 162542819 |
| Molecular Formula | C23H22F3NO3 |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | (3R,4S)-1-pyridin-3-yl-4-[4-[2-(trifluoromethoxy)phenyl]phenoxy]pentan-3-ol |
| SMILES | C[C@H](Oc1ccc(-c2ccccc2OC(F)(F)F)cc1)[C@H](O)CCc1cccnc1 |
| InChI | InChI=1S/C23H22F3NO3/c1-16(21(28)13-8-17-5-4-14-27-15-17)29-19-11-9-18(10-12-19)20-6-2-3-7-22(20)30-23(24,25)26/h2-7,9-12,14-16,21,28H,8,13H2,1H3/t16-,21+/m0/s1 |
| InChIKey | SVIFEXLCPJLSBP-HRAATJIYSA-N |
| XLogP | 5.41 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |