C25H30N2O2 — CID 59970499
(3R,4S)-4-[4-[3-[2-(methylamino)ethyl]phenyl]phenoxy]-1-pyridin-3-ylpentan-3-ol (PubChem CID 59970499) has the molecular formula C25H30N2O2 and a molecular weight of 390.53 g/mol. Its IUPAC name is (3R,4S)-4-[4-[3-[2-(methylamino)ethyl]phenyl]phenoxy]-1-pyridin-3-ylpentan-3-ol.
| Compound Name | (3R,4S)-4-[4-[3-[2-(methylamino)ethyl]phenyl]phenoxy]-1-pyridin-3-ylpentan-3-ol |
|---|---|
| PubChem CID | 59970499 |
| Molecular Formula | C25H30N2O2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | (3R,4S)-4-[4-[3-[2-(methylamino)ethyl]phenyl]phenoxy]-1-pyridin-3-ylpentan-3-ol |
| SMILES | CNCCc1cccc(-c2ccc(O[C@@H](C)[C@H](O)CCc3cccnc3)cc2)c1 |
| InChI | InChI=1S/C25H30N2O2/c1-19(25(28)13-8-21-6-4-15-27-18-21)29-24-11-9-22(10-12-24)23-7-3-5-20(17-23)14-16-26-2/h3-7,9-12,15,17-19,25-26,28H,8,13-14,16H2,1-2H3/t19-,25+/m0/s1 |
| InChIKey | CGAKNBDTBNLIHQ-UQBPGWFLSA-N |
| XLogP | 4.27 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |