C46H42Cl2N2O6 — CID 70240920
bis[(3R,4S)-4-[4-(3-chlorophenyl)phenoxy]-1-pyridin-3-ylpentan-3-yl] oxalate (PubChem CID 70240920) has the molecular formula C46H42Cl2N2O6 and a molecular weight of 789.76 g/mol. Its IUPAC name is bis[(3R,4S)-4-[4-(3-chlorophenyl)phenoxy]-1-pyridin-3-ylpentan-3-yl] oxalate.
| Compound Name | bis[(3R,4S)-4-[4-(3-chlorophenyl)phenoxy]-1-pyridin-3-ylpentan-3-yl] oxalate |
|---|---|
| PubChem CID | 70240920 |
| Molecular Formula | C46H42Cl2N2O6 |
| Molecular Weight | 789.76 g/mol |
| Exact Mass | 788.24 |
| IUPAC Name | bis[(3R,4S)-4-[4-(3-chlorophenyl)phenoxy]-1-pyridin-3-ylpentan-3-yl] oxalate |
| SMILES | C[C@H](Oc1ccc(-c2cccc(Cl)c2)cc1)[C@@H](CCc1cccnc1)OC(=O)C(=O)O[C@H](CCc1cccnc1)[C@H](C)Oc1ccc(-c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C46H42Cl2N2O6/c1-31(53-41-19-15-35(16-20-41)37-9-3-11-39(47)27-37)43(23-13-33-7-5-25-49-29-33)55-45(51)46(52)56-44(24-14-34-8-6-26-50-30-34)32(2)54-42-21-17-36(18-22-42)38-10-4-12-40(48)28-38/h3-12,15-22,25-32,43-44H,13-14,23-24H2,1-2H3/t31-,32-,43+,44+/m0/s1 |
| InChIKey | VBMVLSVBABDLAR-RMFUSXDHSA-N |
| XLogP | 10.44 |
| TPSA | 96.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.76 |
| LogP ≤ 5 | 10.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|