C23H27N3O5 — CID 54293771
benzyl 4-[[(2S)-2-amino-3-phenylpropanoyl]oxycarbamoyl]piperidine-1-carboxylate (PubChem CID 54293771) has the molecular formula C23H27N3O5 and a molecular weight of 425.49 g/mol. Its IUPAC name is benzyl 4-[[(2S)-2-amino-3-phenylpropanoyl]oxycarbamoyl]piperidine-1-carboxylate.
| Compound Name | benzyl 4-[[(2S)-2-amino-3-phenylpropanoyl]oxycarbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 54293771 |
| Molecular Formula | C23H27N3O5 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | benzyl 4-[[(2S)-2-amino-3-phenylpropanoyl]oxycarbamoyl]piperidine-1-carboxylate |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)ONC(=O)C1CCN(C(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C23H27N3O5/c24-20(15-17-7-3-1-4-8-17)22(28)31-25-21(27)19-11-13-26(14-12-19)23(29)30-16-18-9-5-2-6-10-18/h1-10,19-20H,11-16,24H2,(H,25,27)/t20-/m0/s1 |
| InChIKey | RZIRDQHWAIKPPT-FQEVSTJZSA-N |
| XLogP | 2.18 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|