C25H23N7O6S3 — CID 54295421
(6S)-7-[[2-(3-hydroxyphenyl)-2-(phenylsulfanylmethoxyimino)acetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 54295421) has the molecular formula C25H23N7O6S3 and a molecular weight of 613.70 g/mol. Its IUPAC name is (6S)-7-[[2-(3-hydroxyphenyl)-2-(phenylsulfanylmethoxyimino)acetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6S)-7-[[2-(3-hydroxyphenyl)-2-(phenylsulfanylmethoxyimino)acetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 54295421 |
| Molecular Formula | C25H23N7O6S3 |
| Molecular Weight | 613.70 g/mol |
| Exact Mass | 613.09 |
| IUPAC Name | (6S)-7-[[2-(3-hydroxyphenyl)-2-(phenylsulfanylmethoxyimino)acetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | Cn1nnnc1SCC1=C(C(=O)O)N2C(=O)C(NC(=O)C(=NOCSc3ccccc3)c3cccc(O)c3)[C@@H]2SC1 |
| InChI | InChI=1S/C25H23N7O6S3/c1-31-25(27-29-30-31)40-12-15-11-39-23-19(22(35)32(23)20(15)24(36)37)26-21(34)18(14-6-5-7-16(33)10-14)28-38-13-41-17-8-3-2-4-9-17/h2-10,19,23,33H,11-13H2,1H3,(H,26,34)(H,36,37)/t19?,23-/m0/s1 |
| InChIKey | SALOBMMZZLLPHS-BVHINDKJSA-N |
| XLogP | 1.92 |
| TPSA | 172.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.70 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|