C24H35F3O5S — CID 54298117
methyl 7-[(2R)-3,5-dihydroxy-2-[3-hydroxy-4-[3-(trifluoromethyl)phenyl]sulfanylbutyl]cyclopentyl]heptanoate (PubChem CID 54298117) has the molecular formula C24H35F3O5S and a molecular weight of 492.60 g/mol. Its IUPAC name is methyl 7-[(2R)-3,5-dihydroxy-2-[3-hydroxy-4-[3-(trifluoromethyl)phenyl]sulfanylbutyl]cyclopentyl]heptanoate.
| Compound Name | methyl 7-[(2R)-3,5-dihydroxy-2-[3-hydroxy-4-[3-(trifluoromethyl)phenyl]sulfanylbutyl]cyclopentyl]heptanoate |
|---|---|
| PubChem CID | 54298117 |
| Molecular Formula | C24H35F3O5S |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | methyl 7-[(2R)-3,5-dihydroxy-2-[3-hydroxy-4-[3-(trifluoromethyl)phenyl]sulfanylbutyl]cyclopentyl]heptanoate |
| SMILES | COC(=O)CCCCCCC1C(O)CC(O)[C@@H]1CCC(O)CSc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H35F3O5S/c1-32-23(31)10-5-3-2-4-9-19-20(22(30)14-21(19)29)12-11-17(28)15-33-18-8-6-7-16(13-18)24(25,26)27/h6-8,13,17,19-22,28-30H,2-5,9-12,14-15H2,1H3/t17?,19?,20-,21?,22?/m1/s1 |
| InChIKey | SCFFQDZDPPFEDM-SXBVOYEGSA-N |
| XLogP | 4.81 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.60 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|