C30H52O — CID 54298789
(4R,9R,10R,13R,17R)-4-ethyl-4,10,13-trimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,5,6,7,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 54298789) has the molecular formula C30H52O and a molecular weight of 428.75 g/mol. Its IUPAC name is (4R,9R,10R,13R,17R)-4-ethyl-4,10,13-trimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,5,6,7,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (4R,9R,10R,13R,17R)-4-ethyl-4,10,13-trimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,5,6,7,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 54298789 |
| Molecular Formula | C30H52O |
| Molecular Weight | 428.75 g/mol |
| Exact Mass | 428.40 |
| IUPAC Name | (4R,9R,10R,13R,17R)-4-ethyl-4,10,13-trimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,5,6,7,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | CC[C@@]1(C)C(O)CC[C@@]2(C)C1CCC1=C3CC[C@H]([C@H](C)CCCC(C)C)[C@@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C30H52O/c1-8-28(5)26-15-12-22-24-14-13-23(21(4)11-9-10-20(2)3)29(24,6)18-16-25(22)30(26,7)19-17-27(28)31/h20-21,23,25-27,31H,8-19H2,1-7H3/t21-,23-,25+,26?,27?,28-,29-,30-/m1/s1 |
| InChIKey | SCRPJZWGLLOZBL-FHIXYIGISA-N |
| XLogP | 8.56 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.75 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|