C28H43F3O — CID 57260079
(3S,9S,10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-3-(trifluoromethyl)-1,2,6,7,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 57260079) has the molecular formula C28H43F3O and a molecular weight of 452.65 g/mol. Its IUPAC name is (3S,9S,10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-3-(trifluoromethyl)-1,2,6,7,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,9S,10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-3-(trifluoromethyl)-1,2,6,7,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 57260079 |
| Molecular Formula | C28H43F3O |
| Molecular Weight | 452.65 g/mol |
| Exact Mass | 452.33 |
| IUPAC Name | (3S,9S,10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-3-(trifluoromethyl)-1,2,6,7,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CCC2=C3CCC4=C[C@](O)(C(F)(F)F)CC[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C28H43F3O/c1-18(2)7-6-8-19(3)22-11-12-23-21-10-9-20-17-27(32,28(29,30)31)16-15-25(20,4)24(21)13-14-26(22,23)5/h17-19,22,24,32H,6-16H2,1-5H3/t19-,22-,24+,25+,26-,27+/m1/s1 |
| InChIKey | PEUHLURHXWNMKC-XMWYHQSJSA-N |
| XLogP | 8.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.65 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|