C20H34O3 — CID 11834254
[(3'R,3'aS)-3'-[(2R)-6-methylheptan-2-yl]spiro[1,3-dioxolane-2,6'-2,3,4,5-tetrahydro-1H-indene]-3'a-yl]methanol (PubChem CID 11834254) has the molecular formula C20H34O3 and a molecular weight of 322.49 g/mol. Its IUPAC name is [(3'R,3'aS)-3'-[(2R)-6-methylheptan-2-yl]spiro[1,3-dioxolane-2,6'-2,3,4,5-tetrahydro-1H-indene]-3'a-yl]methanol.
| Compound Name | [(3'R,3'aS)-3'-[(2R)-6-methylheptan-2-yl]spiro[1,3-dioxolane-2,6'-2,3,4,5-tetrahydro-1H-indene]-3'a-yl]methanol |
|---|---|
| PubChem CID | 11834254 |
| Molecular Formula | C20H34O3 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | [(3'R,3'aS)-3'-[(2R)-6-methylheptan-2-yl]spiro[1,3-dioxolane-2,6'-2,3,4,5-tetrahydro-1H-indene]-3'a-yl]methanol |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CCC2=CC3(CC[C@@]21CO)OCCO3 |
| InChI | InChI=1S/C20H34O3/c1-15(2)5-4-6-16(3)18-8-7-17-13-20(22-11-12-23-20)10-9-19(17,18)14-21/h13,15-16,18,21H,4-12,14H2,1-3H3/t16-,18-,19-/m1/s1 |
| InChIKey | FFWLBVSSENSFPL-BHIYHBOVSA-N |
| XLogP | 4.30 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|