C21H38O3 — CID 10936688
[(1'S,3'aR,4'S,7'aS)-7'a-methyl-1'-[(2S)-6-methylheptan-2-yl]spiro[1,3-dioxolane-2,5'-2,3,3a,4,6,7-hexahydro-1H-indene]-4'-yl]methanol (PubChem CID 10936688) has the molecular formula C21H38O3 and a molecular weight of 338.53 g/mol. Its IUPAC name is [(1'S,3'aR,4'S,7'aS)-7'a-methyl-1'-[(2S)-6-methylheptan-2-yl]spiro[1,3-dioxolane-2,5'-2,3,3a,4,6,7-hexahydro-1H-indene]-4'-yl]methanol.
| Compound Name | [(1'S,3'aR,4'S,7'aS)-7'a-methyl-1'-[(2S)-6-methylheptan-2-yl]spiro[1,3-dioxolane-2,5'-2,3,3a,4,6,7-hexahydro-1H-indene]-4'-yl]methanol |
|---|---|
| PubChem CID | 10936688 |
| Molecular Formula | C21H38O3 |
| Molecular Weight | 338.53 g/mol |
| Exact Mass | 338.28 |
| IUPAC Name | [(1'S,3'aR,4'S,7'aS)-7'a-methyl-1'-[(2S)-6-methylheptan-2-yl]spiro[1,3-dioxolane-2,5'-2,3,3a,4,6,7-hexahydro-1H-indene]-4'-yl]methanol |
| SMILES | CC(C)CCC[C@H](C)[C@@H]1CC[C@@H]2[C@@H](CO)C3(CC[C@]21C)OCCO3 |
| InChI | InChI=1S/C21H38O3/c1-15(2)6-5-7-16(3)17-8-9-18-19(14-22)21(23-12-13-24-21)11-10-20(17,18)4/h15-19,22H,5-14H2,1-4H3/t16-,17-,18+,19+,20-/m0/s1 |
| InChIKey | ZZBMDOMFQGVCQO-OMZCGLGVSA-N |
| XLogP | 4.63 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.53 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |