C32H54O2 — CID 71438275
10',13'-dimethyl-17'-(6-methylheptan-2-yl)-2'-propan-2-ylidenespiro[1,3-dioxolane-2,3'-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene] (PubChem CID 71438275) has the molecular formula C32H54O2 and a molecular weight of 470.78 g/mol. Its IUPAC name is 10',13'-dimethyl-17'-(6-methylheptan-2-yl)-2'-propan-2-ylidenespiro[1,3-dioxolane-2,3'-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene].
| Compound Name | 10',13'-dimethyl-17'-(6-methylheptan-2-yl)-2'-propan-2-ylidenespiro[1,3-dioxolane-2,3'-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene] |
|---|---|
| PubChem CID | 71438275 |
| Molecular Formula | C32H54O2 |
| Molecular Weight | 470.78 g/mol |
| Exact Mass | 470.41 |
| IUPAC Name | 10',13'-dimethyl-17'-(6-methylheptan-2-yl)-2'-propan-2-ylidenespiro[1,3-dioxolane-2,3'-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene] |
| SMILES | CC(C)=C1CC2(C)C(CCC3C2CCC2(C)C(C(C)CCCC(C)C)CCC32)CC12OCCO2 |
| InChI | InChI=1S/C32H54O2/c1-21(2)9-8-10-23(5)26-13-14-27-25-12-11-24-19-32(33-17-18-34-32)29(22(3)4)20-31(24,7)28(25)15-16-30(26,27)6/h21,23-28H,8-20H2,1-7H3 |
| InChIKey | RQCFBLKZDXXWHV-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.78 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|