C27H46O2 — CID 143412613
(3R,3aR,9aR,10S)-10-(hydroxymethyl)-3a,5b-dimethyl-3-[(2R)-6-methylheptan-2-yl]-2,3,4,5,5a,6,7,10,10a,10b-decahydro-1H-cyclopenta[a]fluoren-9a-ol (PubChem CID 143412613) has the molecular formula C27H46O2 and a molecular weight of 402.66 g/mol. Its IUPAC name is (3R,3aR,9aR,10S)-10-(hydroxymethyl)-3a,5b-dimethyl-3-[(2R)-6-methylheptan-2-yl]-2,3,4,5,5a,6,7,10,10a,10b-decahydro-1H-cyclopenta[a]fluoren-9a-ol.
| Compound Name | (3R,3aR,9aR,10S)-10-(hydroxymethyl)-3a,5b-dimethyl-3-[(2R)-6-methylheptan-2-yl]-2,3,4,5,5a,6,7,10,10a,10b-decahydro-1H-cyclopenta[a]fluoren-9a-ol |
|---|---|
| PubChem CID | 143412613 |
| Molecular Formula | C27H46O2 |
| Molecular Weight | 402.66 g/mol |
| Exact Mass | 402.35 |
| IUPAC Name | (3R,3aR,9aR,10S)-10-(hydroxymethyl)-3a,5b-dimethyl-3-[(2R)-6-methylheptan-2-yl]-2,3,4,5,5a,6,7,10,10a,10b-decahydro-1H-cyclopenta[a]fluoren-9a-ol |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CCC2C3C(CC[C@@]21C)C1(C)CCC=C[C@@]1(O)C3CO |
| InChI | InChI=1S/C27H46O2/c1-18(2)9-8-10-19(3)20-11-12-21-24-22(13-16-25(20,21)4)26(5)14-6-7-15-27(26,29)23(24)17-28/h7,15,18-24,28-29H,6,8-14,16-17H2,1-5H3/t19-,20-,21?,22?,23?,24?,25-,26?,27-/m1/s1 |
| InChIKey | YHMXFRAKVMAOJM-UUFRDUCFSA-N |
| XLogP | 6.22 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.66 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|