C27H48O2 — CID 125036192
3-[(3S,3aS,5aS,6R,9aS,9bR)-7-(hydroxymethyl)-3a,6-dimethyl-3-[(2S)-6-methylheptan-2-yl]-2,3,4,5,5a,9,9a,9b-octahydro-1H-cyclopenta[a]naphthalen-6-yl]propan-1-ol (PubChem CID 125036192) has the molecular formula C27H48O2 and a molecular weight of 404.68 g/mol. Its IUPAC name is 3-[(3S,3aS,5aS,6R,9aS,9bR)-7-(hydroxymethyl)-3a,6-dimethyl-3-[(2S)-6-methylheptan-2-yl]-2,3,4,5,5a,9,9a,9b-octahydro-1H-cyclopenta[a]naphthalen-6-yl]propan-1-ol.
| Compound Name | 3-[(3S,3aS,5aS,6R,9aS,9bR)-7-(hydroxymethyl)-3a,6-dimethyl-3-[(2S)-6-methylheptan-2-yl]-2,3,4,5,5a,9,9a,9b-octahydro-1H-cyclopenta[a]naphthalen-6-yl]propan-1-ol |
|---|---|
| PubChem CID | 125036192 |
| Molecular Formula | C27H48O2 |
| Molecular Weight | 404.68 g/mol |
| Exact Mass | 404.37 |
| IUPAC Name | 3-[(3S,3aS,5aS,6R,9aS,9bR)-7-(hydroxymethyl)-3a,6-dimethyl-3-[(2S)-6-methylheptan-2-yl]-2,3,4,5,5a,9,9a,9b-octahydro-1H-cyclopenta[a]naphthalen-6-yl]propan-1-ol |
| SMILES | CC(C)CCC[C@H](C)[C@@H]1CC[C@@H]2[C@@H]3CC=C(CO)[C@](C)(CCCO)[C@H]3CC[C@]21C |
| InChI | InChI=1S/C27H48O2/c1-19(2)8-6-9-20(3)23-12-13-24-22-11-10-21(18-29)26(4,15-7-17-28)25(22)14-16-27(23,24)5/h10,19-20,22-25,28-29H,6-9,11-18H2,1-5H3/t20-,22-,23-,24+,25-,26-,27-/m0/s1 |
| InChIKey | UXVVJRAORJQTJX-YDHZLJAISA-N |
| XLogP | 6.61 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.68 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|