C29H52 — CID 91266956
3a,6,7-trimethyl-6-(3-methylbutyl)-3-(6-methylheptan-2-yl)-2,3,4,5,5a,9,9a,9b-octahydro-1H-cyclopenta[a]naphthalene (PubChem CID 91266956) has the molecular formula C29H52 and a molecular weight of 400.74 g/mol. Its IUPAC name is 3a,6,7-trimethyl-6-(3-methylbutyl)-3-(6-methylheptan-2-yl)-2,3,4,5,5a,9,9a,9b-octahydro-1H-cyclopenta[a]naphthalene.
| Compound Name | 3a,6,7-trimethyl-6-(3-methylbutyl)-3-(6-methylheptan-2-yl)-2,3,4,5,5a,9,9a,9b-octahydro-1H-cyclopenta[a]naphthalene |
|---|---|
| PubChem CID | 91266956 |
| Molecular Formula | C29H52 |
| Molecular Weight | 400.74 g/mol |
| Exact Mass | 400.41 |
| IUPAC Name | 3a,6,7-trimethyl-6-(3-methylbutyl)-3-(6-methylheptan-2-yl)-2,3,4,5,5a,9,9a,9b-octahydro-1H-cyclopenta[a]naphthalene |
| SMILES | CC1=CCC2C(CCC3(C)C(C(C)CCCC(C)C)CCC23)C1(C)CCC(C)C |
| InChI | InChI=1S/C29H52/c1-20(2)10-9-11-22(5)25-14-15-26-24-13-12-23(6)28(7,18-16-21(3)4)27(24)17-19-29(25,26)8/h12,20-22,24-27H,9-11,13-19H2,1-8H3 |
| InChIKey | FZXZENLRMUUVGQ-UHFFFAOYSA-N |
| XLogP | 9.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.74 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|