C27H48 — CID 145361419
(3aR,6R)-6,7-diethyl-3a,6-dimethyl-3-[(2S)-6-methylheptan-2-yl]-2,3,4,5,5a,9,9a,9b-octahydro-1H-cyclopenta[a]naphthalene (PubChem CID 145361419) has the molecular formula C27H48 and a molecular weight of 372.68 g/mol. Its IUPAC name is (3aR,6R)-6,7-diethyl-3a,6-dimethyl-3-[(2S)-6-methylheptan-2-yl]-2,3,4,5,5a,9,9a,9b-octahydro-1H-cyclopenta[a]naphthalene.
| Compound Name | (3aR,6R)-6,7-diethyl-3a,6-dimethyl-3-[(2S)-6-methylheptan-2-yl]-2,3,4,5,5a,9,9a,9b-octahydro-1H-cyclopenta[a]naphthalene |
|---|---|
| PubChem CID | 145361419 |
| Molecular Formula | C27H48 |
| Molecular Weight | 372.68 g/mol |
| Exact Mass | 372.38 |
| IUPAC Name | (3aR,6R)-6,7-diethyl-3a,6-dimethyl-3-[(2S)-6-methylheptan-2-yl]-2,3,4,5,5a,9,9a,9b-octahydro-1H-cyclopenta[a]naphthalene |
| SMILES | CCC1=CCC2C3CCC([C@@H](C)CCCC(C)C)[C@@]3(C)CCC2[C@@]1(C)CC |
| InChI | InChI=1S/C27H48/c1-8-21-13-14-22-24-16-15-23(20(5)12-10-11-19(3)4)27(24,7)18-17-25(22)26(21,6)9-2/h13,19-20,22-25H,8-12,14-18H2,1-7H3/t20-,22?,23?,24?,25?,26-,27+/m0/s1 |
| InChIKey | HNIXXHNDNQKNTA-JRDZKQQGSA-N |
| XLogP | 8.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.68 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|