About 4-(2-methylpenta-1,3-dienyl)morpholine
4-(2-methylpenta-1,3-dienyl)morpholine (PubChem CID 54302356) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is 4-(2-methylpenta-1,3-dienyl)morpholine.
Molecular Properties
| Compound Name | 4-(2-methylpenta-1,3-dienyl)morpholine |
| PubChem CID | 54302356 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 4-(2-methylpenta-1,3-dienyl)morpholine |
| SMILES | CC=CC(C)=CN1CCOCC1 |
| InChI | InChI=1S/C10H17NO/c1-3-4-10(2)9-11-5-7-12-8-6-11/h3-4,9H,5-8H2,1-2H3 |
| InChIKey | SFDBTBLSCMSIJE-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-methylpenta-1,3-dienyl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methylpenta-1,3-dienyl)morpholine?
The IUPAC name of 4-(2-methylpenta-1,3-dienyl)morpholine (CID 54302356) is 4-(2-methylpenta-1,3-dienyl)morpholine.
What is the SMILES notation for 4-(2-methylpenta-1,3-dienyl)morpholine?
The canonical SMILES for 4-(2-methylpenta-1,3-dienyl)morpholine is CC=CC(C)=CN1CCOCC1.
What is the InChIKey of 4-(2-methylpenta-1,3-dienyl)morpholine?
The InChIKey is SFDBTBLSCMSIJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO/c1-3-4-10(2)9-11-5-7-12-8-6-11/h3-4,9H,5-8H2,1-2H3.
What are the key properties of 4-(2-methylpenta-1,3-dienyl)morpholine?
4-(2-methylpenta-1,3-dienyl)morpholine has a molecular weight of 167.25 g/mol, XLogP of 1.80, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methylpenta-1,3-dienyl)morpholine is sourced from PubChem (CID 54302356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).