C21H25FN4O3 — CID 54303619
(2S)-2-(3-fluorophenyl)-3-[[2-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethylamino]acetyl]amino]propanoic acid (PubChem CID 54303619) has the molecular formula C21H25FN4O3 and a molecular weight of 400.45 g/mol. Its IUPAC name is (2S)-2-(3-fluorophenyl)-3-[[2-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethylamino]acetyl]amino]propanoic acid.
| Compound Name | (2S)-2-(3-fluorophenyl)-3-[[2-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethylamino]acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 54303619 |
| Molecular Formula | C21H25FN4O3 |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | (2S)-2-(3-fluorophenyl)-3-[[2-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethylamino]acetyl]amino]propanoic acid |
| SMILES | O=C(CNCCc1ccc2c(n1)NCCC2)NC[C@@H](C(=O)O)c1cccc(F)c1 |
| InChI | InChI=1S/C21H25FN4O3/c22-16-5-1-3-15(11-16)18(21(28)29)12-25-19(27)13-23-10-8-17-7-6-14-4-2-9-24-20(14)26-17/h1,3,5-7,11,18,23H,2,4,8-10,12-13H2,(H,24,26)(H,25,27)(H,28,29)/t18-/m1/s1 |
| InChIKey | SFYFAARXLBYIFS-GOSISDBHSA-N |
| XLogP | 1.70 |
| TPSA | 103.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|