C12H12Br6O2 — CID 54304423
2,2-bis(2,2,2-tribromoethoxy)ethylbenzene (PubChem CID 54304423) has the molecular formula C12H12Br6O2 and a molecular weight of 667.65 g/mol. Its IUPAC name is 2,2-bis(2,2,2-tribromoethoxy)ethylbenzene.
| Compound Name | 2,2-bis(2,2,2-tribromoethoxy)ethylbenzene |
|---|---|
| PubChem CID | 54304423 |
| Molecular Formula | C12H12Br6O2 |
| Molecular Weight | 667.65 g/mol |
| Exact Mass | 661.59 |
| IUPAC Name | 2,2-bis(2,2,2-tribromoethoxy)ethylbenzene |
| SMILES | BrC(Br)(Br)COC(Cc1ccccc1)OCC(Br)(Br)Br |
| InChI | InChI=1S/C12H12Br6O2/c13-11(14,15)7-19-10(20-8-12(16,17)18)6-9-4-2-1-3-5-9/h1-5,10H,6-8H2 |
| InChIKey | SGMUVNNRKQOKMT-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.65 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|