C16H25FO4 — CID 54308328
(3aS,4S,5S,6aR)-4-[(3R)-4-fluoro-3-hydroxy-4-methyloct-1-enyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 54308328) has the molecular formula C16H25FO4 and a molecular weight of 300.37 g/mol. Its IUPAC name is (3aS,4S,5S,6aR)-4-[(3R)-4-fluoro-3-hydroxy-4-methyloct-1-enyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aS,4S,5S,6aR)-4-[(3R)-4-fluoro-3-hydroxy-4-methyloct-1-enyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 54308328 |
| Molecular Formula | C16H25FO4 |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | (3aS,4S,5S,6aR)-4-[(3R)-4-fluoro-3-hydroxy-4-methyloct-1-enyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | CCCCC(C)(F)[C@H](O)C=C[C@H]1[C@@H]2CC(=O)O[C@@H]2C[C@@H]1O |
| InChI | InChI=1S/C16H25FO4/c1-3-4-7-16(2,17)14(19)6-5-10-11-8-15(20)21-13(11)9-12(10)18/h5-6,10-14,18-19H,3-4,7-9H2,1-2H3/t10-,11-,12-,13+,14+,16?/m0/s1 |
| InChIKey | SJCNVESQUFHUFR-WEWFJDAFSA-N |
| XLogP | 2.13 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|