C18H28N2O7S — CID 54308338
1-(2,2-dimethylpropanoyloxy)ethyl (6S)-7-amino-3-(2-methoxyethoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 54308338) has the molecular formula C18H28N2O7S and a molecular weight of 416.50 g/mol. Its IUPAC name is 1-(2,2-dimethylpropanoyloxy)ethyl (6S)-7-amino-3-(2-methoxyethoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | 1-(2,2-dimethylpropanoyloxy)ethyl (6S)-7-amino-3-(2-methoxyethoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 54308338 |
| Molecular Formula | C18H28N2O7S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 1-(2,2-dimethylpropanoyloxy)ethyl (6S)-7-amino-3-(2-methoxyethoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | COCCOCC1=C(C(=O)OC(C)OC(=O)C(C)(C)C)N2C(=O)C(N)[C@@H]2SC1 |
| InChI | InChI=1S/C18H28N2O7S/c1-10(27-17(23)18(2,3)4)26-16(22)13-11(8-25-7-6-24-5)9-28-15-12(19)14(21)20(13)15/h10,12,15H,6-9,19H2,1-5H3/t10?,12?,15-/m0/s1 |
| InChIKey | SJCRTPLTJIWUTN-QHAMSDLMSA-N |
| XLogP | 0.62 |
| TPSA | 117.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|