C22H31BrN2O9S — CID 54504854
1-(2,2-dimethylpropanoyloxy)ethyl (6S)-7-[(4-bromo-3-oxobutanoyl)amino]-3-(2-methoxyethoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 54504854) has the molecular formula C22H31BrN2O9S and a molecular weight of 579.47 g/mol. Its IUPAC name is 1-(2,2-dimethylpropanoyloxy)ethyl (6S)-7-[(4-bromo-3-oxobutanoyl)amino]-3-(2-methoxyethoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | 1-(2,2-dimethylpropanoyloxy)ethyl (6S)-7-[(4-bromo-3-oxobutanoyl)amino]-3-(2-methoxyethoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 54504854 |
| Molecular Formula | C22H31BrN2O9S |
| Molecular Weight | 579.47 g/mol |
| Exact Mass | 578.09 |
| IUPAC Name | 1-(2,2-dimethylpropanoyloxy)ethyl (6S)-7-[(4-bromo-3-oxobutanoyl)amino]-3-(2-methoxyethoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | COCCOCC1=C(C(=O)OC(C)OC(=O)C(C)(C)C)N2C(=O)C(NC(=O)CC(=O)CBr)[C@@H]2SC1 |
| InChI | InChI=1S/C22H31BrN2O9S/c1-12(34-21(30)22(2,3)4)33-20(29)17-13(10-32-7-6-31-5)11-35-19-16(18(28)25(17)19)24-15(27)8-14(26)9-23/h12,16,19H,6-11H2,1-5H3,(H,24,27)/t12?,16?,19-/m0/s1 |
| InChIKey | YEYPABSJNQPCPM-ZXNWCJJNSA-N |
| XLogP | 1.14 |
| TPSA | 137.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.47 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|