C19H25BrN2O8S — CID 88690516
2,2-dimethylpropanoyloxymethyl (6R)-7-[(4-bromo-3-oxobutanoyl)amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 88690516) has the molecular formula C19H25BrN2O8S and a molecular weight of 521.39 g/mol. Its IUPAC name is 2,2-dimethylpropanoyloxymethyl (6R)-7-[(4-bromo-3-oxobutanoyl)amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | 2,2-dimethylpropanoyloxymethyl (6R)-7-[(4-bromo-3-oxobutanoyl)amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 88690516 |
| Molecular Formula | C19H25BrN2O8S |
| Molecular Weight | 521.39 g/mol |
| Exact Mass | 520.05 |
| IUPAC Name | 2,2-dimethylpropanoyloxymethyl (6R)-7-[(4-bromo-3-oxobutanoyl)amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | COCC1=C(C(=O)OCOC(=O)C(C)(C)C)N2C(=O)C(NC(=O)CC(=O)CBr)[C@H]2SC1 |
| InChI | InChI=1S/C19H25BrN2O8S/c1-19(2,3)18(27)30-9-29-17(26)14-10(7-28-4)8-31-16-13(15(25)22(14)16)21-12(24)5-11(23)6-20/h13,16H,5-9H2,1-4H3,(H,21,24)/t13?,16-/m1/s1 |
| InChIKey | WBBUJXBDIUZTAU-FQNRMIAFSA-N |
| XLogP | 0.73 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.39 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|